C14H24N2O3 — CID 104594510
8-[2-(2-hydroxypropylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 104594510) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 8-[2-(2-hydroxypropylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[2-(2-hydroxypropylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 104594510 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 8-[2-(2-hydroxypropylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | CC(O)CNCCN1C(=O)CC2(CCCC2)CC1=O |
| InChI | InChI=1S/C14H24N2O3/c1-11(17)10-15-6-7-16-12(18)8-14(9-13(16)19)4-2-3-5-14/h11,15,17H,2-10H2,1H3 |
| InChIKey | SOLQUTMBPVXYCV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|