C15H22N2 — CID 104595002
2-[(2-methylpiperidin-2-yl)methyl]-1,3-dihydroisoindole (PubChem CID 104595002) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(2-methylpiperidin-2-yl)methyl]-1,3-dihydroisoindole.
| Compound Name | 2-[(2-methylpiperidin-2-yl)methyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 104595002 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-[(2-methylpiperidin-2-yl)methyl]-1,3-dihydroisoindole |
| SMILES | CC1(CN2Cc3ccccc3C2)CCCCN1 |
| InChI | InChI=1S/C15H22N2/c1-15(8-4-5-9-16-15)12-17-10-13-6-2-3-7-14(13)11-17/h2-3,6-7,16H,4-5,8-12H2,1H3 |
| InChIKey | ABVSXYXQQXDRIU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |