C12H22N2 — CID 114410563
1-[(2-methylpiperidin-2-yl)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 114410563) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[(2-methylpiperidin-2-yl)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(2-methylpiperidin-2-yl)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 114410563 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-[(2-methylpiperidin-2-yl)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC1(CN2CC=CCC2)CCCCN1 |
| InChI | InChI=1S/C12H22N2/c1-12(7-3-4-8-13-12)11-14-9-5-2-6-10-14/h2,5,13H,3-4,6-11H2,1H3 |
| InChIKey | XIHLEIGFBBATFH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|