C14H14F3NO3 — CID 104595393
2-methyl-1-(2,4,6-trifluorobenzoyl)piperidine-2-carboxylic acid (PubChem CID 104595393) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-methyl-1-(2,4,6-trifluorobenzoyl)piperidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-(2,4,6-trifluorobenzoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104595393 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-methyl-1-(2,4,6-trifluorobenzoyl)piperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCN1C(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H14F3NO3/c1-14(13(20)21)4-2-3-5-18(14)12(19)11-9(16)6-8(15)7-10(11)17/h6-7H,2-5H2,1H3,(H,20,21) |
| InChIKey | GEJRNCXKOPXRIT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |