About 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid
1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid (PubChem CID 104595753) has the molecular formula C13H14F2N2O4
and a molecular weight of 300.26 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid |
| PubChem CID | 104595753 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCN1c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14F2N2O4/c1-13(12(18)19)4-2-3-5-16(13)10-7-8(14)6-9(15)11(10)17(20)21/h6-7H,2-5H2,1H3,(H,18,19) |
| InChIKey | YWEJDOAANXFEFL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid?
The IUPAC name of 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid (CID 104595753) is 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid.
What is the SMILES notation for 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid?
The canonical SMILES for 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid is CC1(C(=O)O)CCCCN1c1cc(F)cc(F)c1[N+](=O)[O-].
What is the InChIKey of 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid?
The InChIKey is YWEJDOAANXFEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O4/c1-13(12(18)19)4-2-3-5-16(13)10-7-8(14)6-9(15)11(10)17(20)21/h6-7H,2-5H2,1H3,(H,18,19).
What are the key properties of 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid?
1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid has a molecular weight of 300.26 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-difluoro-2-nitrophenyl)-2-methylpiperidine-2-carboxylic acid is sourced from PubChem (CID 104595753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).