C11H18N2O — CID 104597142
N,2-dimethyl-N-prop-2-ynylpiperidine-2-carboxamide (PubChem CID 104597142) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N,2-dimethyl-N-prop-2-ynylpiperidine-2-carboxamide.
| Compound Name | N,2-dimethyl-N-prop-2-ynylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 104597142 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N,2-dimethyl-N-prop-2-ynylpiperidine-2-carboxamide |
| SMILES | C#CCN(C)C(=O)C1(C)CCCCN1 |
| InChI | InChI=1S/C11H18N2O/c1-4-9-13(3)10(14)11(2)7-5-6-8-12-11/h1,12H,5-9H2,2-3H3 |
| InChIKey | MTOIWBFMWAZGFL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|