About N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide
N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide (PubChem CID 104596167) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide |
| PubChem CID | 104596167 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide |
| SMILES | CN(C(=O)C1(C)CCCCN1)C1CCCCCC1 |
| InChI | InChI=1S/C15H28N2O/c1-15(11-7-8-12-16-15)14(18)17(2)13-9-5-3-4-6-10-13/h13,16H,3-12H2,1-2H3 |
| InChIKey | HLFYGMSDGAHSPH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide?
The IUPAC name of N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide (CID 104596167) is N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide.
What is the SMILES notation for N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide?
The canonical SMILES for N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide is CN(C(=O)C1(C)CCCCN1)C1CCCCCC1.
What is the InChIKey of N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide?
The InChIKey is HLFYGMSDGAHSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-15(11-7-8-12-16-15)14(18)17(2)13-9-5-3-4-6-10-13/h13,16H,3-12H2,1-2H3.
What are the key properties of N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide?
N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide has a molecular weight of 252.40 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N,2-dimethylpiperidine-2-carboxamide is sourced from PubChem (CID 104596167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).