C12H19F3N2O — CID 55227271
N-cyclopentyl-N-methyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 55227271) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is N-cyclopentyl-N-methyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-cyclopentyl-N-methyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55227271 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-cyclopentyl-N-methyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CN(C(=O)C1(C(F)(F)F)CCNC1)C1CCCC1 |
| InChI | InChI=1S/C12H19F3N2O/c1-17(9-4-2-3-5-9)10(18)11(12(13,14)15)6-7-16-8-11/h9,16H,2-8H2,1H3 |
| InChIKey | HQUWNJHEFCVMEB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |