C13H20F3NO — CID 116572823
(3-methylcyclohexyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone (PubChem CID 116572823) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is (3-methylcyclohexyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone.
| Compound Name | (3-methylcyclohexyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 116572823 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (3-methylcyclohexyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
| SMILES | CC1CCCC(C(=O)C2(C(F)(F)F)CCNC2)C1 |
| InChI | InChI=1S/C13H20F3NO/c1-9-3-2-4-10(7-9)11(18)12(13(14,15)16)5-6-17-8-12/h9-10,17H,2-8H2,1H3 |
| InChIKey | VGVCCPKNPCCEOE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |