C12H19F3N2O3 — CID 63720094
2-[ethyl-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 63720094) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-[ethyl-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 63720094 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[ethyl-[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)C1(C(F)(F)F)CCNC1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H19F3N2O3/c1-4-17(10(2,3)9(19)20)8(18)11(12(13,14)15)5-6-16-7-11/h16H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | PIPXWJFFXARRAW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |