C12H20F3N3O2 — CID 63710228
N-[2-(methylamino)-2-oxoethyl]-N-propyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 63710228) has the molecular formula C12H20F3N3O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-[2-(methylamino)-2-oxoethyl]-N-propyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[2-(methylamino)-2-oxoethyl]-N-propyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63710228 |
| Molecular Formula | C12H20F3N3O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-[2-(methylamino)-2-oxoethyl]-N-propyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CCCN(CC(=O)NC)C(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C12H20F3N3O2/c1-3-6-18(7-9(19)16-2)10(20)11(12(13,14)15)4-5-17-8-11/h17H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | XTMKTQHIFURSCE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |