C13H23F3N2O3 — CID 63710773
N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 63710773) has the molecular formula C13H23F3N2O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63710773 |
| Molecular Formula | C13H23F3N2O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | COCCN(C(=O)C1(C(F)(F)F)CCNC1)C(C)COC |
| InChI | InChI=1S/C13H23F3N2O3/c1-10(8-21-3)18(6-7-20-2)11(19)12(13(14,15)16)4-5-17-9-12/h10,17H,4-9H2,1-3H3 |
| InChIKey | UCSATPBIJXGDLW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |