C11H18F3NO3 — CID 63710529
2-propan-2-yloxyethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate (PubChem CID 63710529) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 63710529 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-propan-2-yloxyethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate |
| SMILES | CC(C)OCCOC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H18F3NO3/c1-8(2)17-5-6-18-9(16)10(11(12,13)14)3-4-15-7-10/h8,15H,3-7H2,1-2H3 |
| InChIKey | UTKYDKXFMMYDRN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|