C11H12F3NO2S — CID 55227065
thiophen-2-ylmethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate (PubChem CID 55227065) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is thiophen-2-ylmethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate.
| Compound Name | thiophen-2-ylmethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55227065 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | thiophen-2-ylmethyl 3-(trifluoromethyl)pyrrolidine-3-carboxylate |
| SMILES | O=C(OCc1cccs1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H12F3NO2S/c12-11(13,14)10(3-4-15-7-10)9(16)17-6-8-2-1-5-18-8/h1-2,5,15H,3-4,6-7H2 |
| InChIKey | BGIRXDIZSIZWKV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |