C11H19F3N2O2 — CID 64605661
N-(4-methoxybutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 64605661) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(4-methoxybutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(4-methoxybutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 64605661 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-(4-methoxybutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | COCCC(C)NC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-8(3-6-18-2)16-9(17)10(11(12,13)14)4-5-15-7-10/h8,15H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | HDGPNIRPYRUQLS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |