C11H15F3N2O5 — CID 63710248
(2S)-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]pentanedioic acid (PubChem CID 63710248) has the molecular formula C11H15F3N2O5 and a molecular weight of 312.24 g/mol. Its IUPAC name is (2S)-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 63710248 |
| Molecular Formula | C11H15F3N2O5 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (2S)-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)C1(C(F)(F)F)CCNC1)C(=O)O |
| InChI | InChI=1S/C11H15F3N2O5/c12-11(13,14)10(3-4-15-5-10)9(21)16-6(8(19)20)1-2-7(17)18/h6,15H,1-5H2,(H,16,21)(H,17,18)(H,19,20)/t6-,10?/m0/s1 |
| InChIKey | WNIQUDYQFCOFOW-UOQJWNSWSA-N |
| XLogP | -0.04 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |