C9H13F3N2O4 — CID 80749492
(2R)-3-hydroxy-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]propanoic acid (PubChem CID 80749492) has the molecular formula C9H13F3N2O4 and a molecular weight of 270.21 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 80749492 |
| Molecular Formula | C9H13F3N2O4 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2R)-3-hydroxy-2-[[3-(trifluoromethyl)pyrrolidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)[C@@H](CO)NC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C9H13F3N2O4/c10-9(11,12)8(1-2-13-4-8)7(18)14-5(3-15)6(16)17/h5,13,15H,1-4H2,(H,14,18)(H,16,17)/t5-,8?/m1/s1 |
| InChIKey | MQQOOWPYOQKBRY-RUQIKYNFSA-N |
| XLogP | -0.91 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |