C11H19F3N2O2S — CID 106161551
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 106161551) has the molecular formula C11H19F3N2O2S and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106161551 |
| Molecular Formula | C11H19F3N2O2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H19F3N2O2S/c1-7(8(5-17)19-2)16-9(18)10(11(12,13)14)3-4-15-6-10/h7-8,15,17H,3-6H2,1-2H3,(H,16,18) |
| InChIKey | GQNFUBSSLCRGNP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |