C11H20F3N3O — CID 82945350
N-[1-(dimethylamino)propan-2-yl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 82945350) has the molecular formula C11H20F3N3O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 82945350 |
| Molecular Formula | C11H20F3N3O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CC(CN(C)C)NC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H20F3N3O/c1-8(6-17(2)3)16-9(18)10(11(12,13)14)4-5-15-7-10/h8,15H,4-7H2,1-3H3,(H,16,18) |
| InChIKey | YNEKBRUPOJNYOS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |