C7H11F3N2O3S — CID 103287344
N-methylsulfonyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 103287344) has the molecular formula C7H11F3N2O3S and a molecular weight of 260.24 g/mol. Its IUPAC name is N-methylsulfonyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-methylsulfonyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 103287344 |
| Molecular Formula | C7H11F3N2O3S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | N-methylsulfonyl-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C7H11F3N2O3S/c1-16(14,15)12-5(13)6(7(8,9)10)2-3-11-4-6/h11H,2-4H2,1H3,(H,12,13) |
| InChIKey | KZWOAYQYDMOAHT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |