C13H19NO2S — CID 104598702
2-methyl-1-(2-thiophen-3-ylethyl)piperidine-2-carboxylic acid (PubChem CID 104598702) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-methyl-1-(2-thiophen-3-ylethyl)piperidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-(2-thiophen-3-ylethyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104598702 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-methyl-1-(2-thiophen-3-ylethyl)piperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCN1CCc1ccsc1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(12(15)16)6-2-3-7-14(13)8-4-11-5-9-17-10-11/h5,9-10H,2-4,6-8H2,1H3,(H,15,16) |
| InChIKey | POGVILPFCDSPSQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |