C9H10O2S — CID 66025291
1-(thiophen-3-ylmethyl)cyclopropane-1-carboxylic acid (PubChem CID 66025291) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 1-(thiophen-3-ylmethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(thiophen-3-ylmethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 66025291 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1-(thiophen-3-ylmethyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C9H10O2S/c10-8(11)9(2-3-9)5-7-1-4-12-6-7/h1,4,6H,2-3,5H2,(H,10,11) |
| InChIKey | WSOMDYUYAILLOU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |