3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid

C10H12O3S — CID 62740627

IUPAC3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid
SMILESO=C(O)C1(Cc2ccsc2)CCOC1
InChIInChI=1S/C10H12O3S/c11-9(12)10(2-3-13-7-10)5-8-1-4-14-6-8/h1,4,6H,2-3,5,7H2,(H,11,12)
InChIKeyAYIBYXJUZUFGRJ-UHFFFAOYSA-N
MW212.27 g/mol
LogP1.78
Rot. Bonds3

About 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid

3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid (PubChem CID 62740627) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid.

Molecular Properties

Compound Name3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid
PubChem CID62740627
Molecular FormulaC10H12O3S
Molecular Weight212.27 g/mol
Exact Mass212.05
IUPAC Name3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid
SMILESO=C(O)C1(Cc2ccsc2)CCOC1
InChIInChI=1S/C10H12O3S/c11-9(12)10(2-3-13-7-10)5-8-1-4-14-6-8/h1,4,6H,2-3,5,7H2,(H,11,12)
InChIKeyAYIBYXJUZUFGRJ-UHFFFAOYSA-N
XLogP1.78
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.27
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-(thiophen-3-ylmethyl)cyclopropane-1-carboxylic acid
CID 66025291
3-[(4-fluorophenyl)methyl]oxolane-3-carboxylic acid
CID 62740795
4-[[(2-thiophen-3-ylacetyl)amino]methyl]oxane-4-carboxylic acid
CID 113309985
1-[(5R)-2,9-dioxa-6-azaspiro[4.5]decan-6-yl]-2-thiophen-3-ylethanone
CID 99841411
3-[(2,4,6-trimethylphenyl)methyl]oxolane-3-carboxylic acid
CID 62739415
3-(3-phenylpropyl)oxolane-3-carboxylic acid
CID 62738542
3-[(3-nitrophenyl)methyl]oxolane-3-carboxylic acid
CID 62740778
3-(2-thiophen-2-ylethyl)oxolane-3-carboxylic acid
CID 63774395
N-methyl-1-[3-(thiophen-3-ylmethyl)oxolan-3-yl]methanamine
CID 62719550
4-(aminomethyl)-N-(thiophen-3-ylmethyl)oxane-4-carboxamide;hydrochloride
CID 120923213
3-[(2,5-dimethylphenyl)methyl]oxolane-3-carboxylic acid
CID 62740971
3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid
CID 55150319

Frequently Asked Questions

What is the IUPAC name of 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid?
The IUPAC name of 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid (CID 62740627) is 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid.
What is the SMILES notation for 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid?
The canonical SMILES for 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid is O=C(O)C1(Cc2ccsc2)CCOC1.
What is the InChIKey of 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid?
The InChIKey is AYIBYXJUZUFGRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c11-9(12)10(2-3-13-7-10)5-8-1-4-14-6-8/h1,4,6H,2-3,5,7H2,(H,11,12).
What are the key properties of 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid?
3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thiophen-3-ylmethyl)oxolane-3-carboxylic acid is sourced from PubChem (CID 62740627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).