C11H14O3S — CID 63774395
3-(2-thiophen-2-ylethyl)oxolane-3-carboxylic acid (PubChem CID 63774395) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-(2-thiophen-2-ylethyl)oxolane-3-carboxylic acid.
| Compound Name | 3-(2-thiophen-2-ylethyl)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 63774395 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-(2-thiophen-2-ylethyl)oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1(CCc2cccs2)CCOC1 |
| InChI | InChI=1S/C11H14O3S/c12-10(13)11(5-6-14-8-11)4-3-9-2-1-7-15-9/h1-2,7H,3-6,8H2,(H,12,13) |
| InChIKey | GRKRLAKHYZTFBO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |