C12H19NOS — CID 65076896
4-(2-thiophen-2-ylethyl)oxepan-4-amine (PubChem CID 65076896) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 4-(2-thiophen-2-ylethyl)oxepan-4-amine.
| Compound Name | 4-(2-thiophen-2-ylethyl)oxepan-4-amine |
|---|---|
| PubChem CID | 65076896 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-(2-thiophen-2-ylethyl)oxepan-4-amine |
| SMILES | NC1(CCc2cccs2)CCCOCC1 |
| InChI | InChI=1S/C12H19NOS/c13-12(5-2-8-14-9-7-12)6-4-11-3-1-10-15-11/h1,3,10H,2,4-9,13H2 |
| InChIKey | DYBKLWWSTLQXDW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |