C12H17NO2S — CID 63774592
4-(2-thiophen-2-ylethyl)piperidine-4-carboxylic acid (PubChem CID 63774592) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(2-thiophen-2-ylethyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(2-thiophen-2-ylethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63774592 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 4-(2-thiophen-2-ylethyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(CCc2cccs2)CCNCC1 |
| InChI | InChI=1S/C12H17NO2S/c14-11(15)12(5-7-13-8-6-12)4-3-10-2-1-9-16-10/h1-2,9,13H,3-8H2,(H,14,15) |
| InChIKey | QSHNHAWXTIJAAE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |