C10H12O4S2 — CID 78991895
1,1-dioxo-3-(thiophen-2-ylmethyl)thiolane-3-carboxylic acid (PubChem CID 78991895) has the molecular formula C10H12O4S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1,1-dioxo-3-(thiophen-2-ylmethyl)thiolane-3-carboxylic acid.
| Compound Name | 1,1-dioxo-3-(thiophen-2-ylmethyl)thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 78991895 |
| Molecular Formula | C10H12O4S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 1,1-dioxo-3-(thiophen-2-ylmethyl)thiolane-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2cccs2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12O4S2/c11-9(12)10(3-5-16(13,14)7-10)6-8-2-1-4-15-8/h1-2,4H,3,5-7H2,(H,11,12) |
| InChIKey | CUQKQQIYPIBMDB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |