C13H17BrN4O — CID 104599966
6-bromo-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-2-methylpyridin-3-amine (PubChem CID 104599966) has the molecular formula C13H17BrN4O and a molecular weight of 325.21 g/mol. Its IUPAC name is 6-bromo-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-2-methylpyridin-3-amine.
| Compound Name | 6-bromo-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-2-methylpyridin-3-amine |
|---|---|
| PubChem CID | 104599966 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 6-bromo-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-2-methylpyridin-3-amine |
| SMILES | COc1c(CNc2ccc(Br)nc2C)c(C)nn1C |
| InChI | InChI=1S/C13H17BrN4O/c1-8-10(13(19-4)18(3)17-8)7-15-11-5-6-12(14)16-9(11)2/h5-6,15H,7H2,1-4H3 |
| InChIKey | JMTQKAGKOWUOAX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|