C13H14BrCl2N3O — CID 107787532
4-bromo-2,3-dichloro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]aniline (PubChem CID 107787532) has the molecular formula C13H14BrCl2N3O and a molecular weight of 379.09 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 107787532 |
| Molecular Formula | C13H14BrCl2N3O |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]aniline |
| SMILES | COc1c(CNc2ccc(Br)c(Cl)c2Cl)c(C)nn1C |
| InChI | InChI=1S/C13H14BrCl2N3O/c1-7-8(13(20-3)19(2)18-7)6-17-10-5-4-9(14)11(15)12(10)16/h4-5,17H,6H2,1-3H3 |
| InChIKey | YUTHUDUAGYKGGN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|