C13H13BrCl3N3 — CID 107789023
4-bromo-2,3-dichloro-N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]aniline (PubChem CID 107789023) has the molecular formula C13H13BrCl3N3 and a molecular weight of 397.53 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 107789023 |
| Molecular Formula | C13H13BrCl3N3 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]aniline |
| SMILES | CCn1nc(C)c(Cl)c1CNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C13H13BrCl3N3/c1-3-20-10(11(15)7(2)19-20)6-18-9-5-4-8(14)12(16)13(9)17/h4-5,18H,3,6H2,1-2H3 |
| InChIKey | MBQMTDLYLBKCMR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|