C16H14BrN3O — CID 104599995
3-[[(6-bromo-2-methyl-3-pyridinyl)amino]methyl]-1H-quinolin-2-one (PubChem CID 104599995) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-[[(6-bromo-2-methyl-3-pyridinyl)amino]methyl]-1H-quinolin-2-one.
| Compound Name | 3-[[(6-bromo-2-methyl-3-pyridinyl)amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 104599995 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-[[(6-bromo-2-methyl-3-pyridinyl)amino]methyl]-1H-quinolin-2-one |
| SMILES | Cc1nc(Br)ccc1NCc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C16H14BrN3O/c1-10-13(6-7-15(17)19-10)18-9-12-8-11-4-2-3-5-14(11)20-16(12)21/h2-8,18H,9H2,1H3,(H,20,21) |
| InChIKey | MGZKNJMXWQURNN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|