C9H18N4O2 — CID 104601260
2-(3-amino-2-oxo-1,3-diazinan-1-yl)-N-ethyl-N-methylacetamide (PubChem CID 104601260) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-(3-amino-2-oxo-1,3-diazinan-1-yl)-N-ethyl-N-methylacetamide.
| Compound Name | 2-(3-amino-2-oxo-1,3-diazinan-1-yl)-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 104601260 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-(3-amino-2-oxo-1,3-diazinan-1-yl)-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CN1CCCN(N)C1=O |
| InChI | InChI=1S/C9H18N4O2/c1-3-11(2)8(14)7-12-5-4-6-13(10)9(12)15/h3-7,10H2,1-2H3 |
| InChIKey | SLIBLHCPBCCBLB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|