C7H15N3O — CID 104601098
1-amino-3-propyl-1,3-diazinan-2-one (PubChem CID 104601098) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-amino-3-propyl-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-propyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601098 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 1-amino-3-propyl-1,3-diazinan-2-one |
| SMILES | CCCN1CCCN(N)C1=O |
| InChI | InChI=1S/C7H15N3O/c1-2-4-9-5-3-6-10(8)7(9)11/h2-6,8H2,1H3 |
| InChIKey | LYVKDBQMJZBDPS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|