C14H29N3O4 — CID 104601095
1-amino-3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-1,3-diazinan-2-one (PubChem CID 104601095) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-amino-3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601095 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-amino-3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-1,3-diazinan-2-one |
| SMILES | CCCCOCCOCCOCCN1CCCN(N)C1=O |
| InChI | InChI=1S/C14H29N3O4/c1-2-3-8-19-10-12-21-13-11-20-9-7-16-5-4-6-17(15)14(16)18/h2-13,15H2,1H3 |
| InChIKey | DNSPWQPTDOYNJH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|