C8H17N3O2 — CID 104601247
1-amino-3-(3-methoxypropyl)-1,3-diazinan-2-one (PubChem CID 104601247) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-amino-3-(3-methoxypropyl)-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-(3-methoxypropyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601247 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 1-amino-3-(3-methoxypropyl)-1,3-diazinan-2-one |
| SMILES | COCCCN1CCCN(N)C1=O |
| InChI | InChI=1S/C8H17N3O2/c1-13-7-3-5-10-4-2-6-11(9)8(10)12/h2-7,9H2,1H3 |
| InChIKey | BADKDMZMCHDIEN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|