C11H21N3O2 — CID 104601266
1-amino-3-[3-(oxolan-2-yl)propyl]-1,3-diazinan-2-one (PubChem CID 104601266) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-amino-3-[3-(oxolan-2-yl)propyl]-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-[3-(oxolan-2-yl)propyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601266 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-amino-3-[3-(oxolan-2-yl)propyl]-1,3-diazinan-2-one |
| SMILES | NN1CCCN(CCCC2CCCO2)C1=O |
| InChI | InChI=1S/C11H21N3O2/c12-14-8-3-7-13(11(14)15)6-1-4-10-5-2-9-16-10/h10H,1-9,12H2 |
| InChIKey | VQFSUBVDFHTJQV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|