C13H23N3O2 — CID 79091376
2-[3-(oxolan-2-yl)propyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091376) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[3-(oxolan-2-yl)propyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 2-[3-(oxolan-2-yl)propyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091376 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[3-(oxolan-2-yl)propyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1N(CCCC2CCCO2)CC2CNCCN12 |
| InChI | InChI=1S/C13H23N3O2/c17-13-15(6-1-3-12-4-2-8-18-12)10-11-9-14-5-7-16(11)13/h11-12,14H,1-10H2 |
| InChIKey | VQPLJRIUQYCFRA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |