C10H17N5O — CID 104601287
1-amino-3-[2-(2-methylimidazol-1-yl)ethyl]-1,3-diazinan-2-one (PubChem CID 104601287) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-amino-3-[2-(2-methylimidazol-1-yl)ethyl]-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-[2-(2-methylimidazol-1-yl)ethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601287 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-amino-3-[2-(2-methylimidazol-1-yl)ethyl]-1,3-diazinan-2-one |
| SMILES | Cc1nccn1CCN1CCCN(N)C1=O |
| InChI | InChI=1S/C10H17N5O/c1-9-12-3-6-13(9)7-8-14-4-2-5-15(11)10(14)16/h3,6H,2,4-5,7-8,11H2,1H3 |
| InChIKey | BDIHNJHOVNHLNW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|