C15H20N4 — CID 61493848
1-[2-(2-methylimidazol-1-yl)ethyl]-3,4-dihydro-2H-quinolin-8-amine (PubChem CID 61493848) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[2-(2-methylimidazol-1-yl)ethyl]-3,4-dihydro-2H-quinolin-8-amine.
| Compound Name | 1-[2-(2-methylimidazol-1-yl)ethyl]-3,4-dihydro-2H-quinolin-8-amine |
|---|---|
| PubChem CID | 61493848 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-[2-(2-methylimidazol-1-yl)ethyl]-3,4-dihydro-2H-quinolin-8-amine |
| SMILES | Cc1nccn1CCN1CCCc2cccc(N)c21 |
| InChI | InChI=1S/C15H20N4/c1-12-17-7-9-18(12)10-11-19-8-3-5-13-4-2-6-14(16)15(13)19/h2,4,6-7,9H,3,5,8,10-11,16H2,1H3 |
| InChIKey | DZFXTBHDIRTHLS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|