C13H26N2O2 — CID 102024168
1,3-bis(3-methoxypropyl)-4,5-dimethyl-2H-imidazole (PubChem CID 102024168) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1,3-bis(3-methoxypropyl)-4,5-dimethyl-2H-imidazole.
| Compound Name | 1,3-bis(3-methoxypropyl)-4,5-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 102024168 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,3-bis(3-methoxypropyl)-4,5-dimethyl-2H-imidazole |
| SMILES | COCCCN1CN(CCCOC)C(C)=C1C |
| InChI | InChI=1S/C13H26N2O2/c1-12-13(2)15(8-6-10-17-4)11-14(12)7-5-9-16-3/h5-11H2,1-4H3 |
| InChIKey | POGDIWJIZSZGNI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|