C12H17N3O — CID 104601169
1-amino-3-[(4-methylphenyl)methyl]-1,3-diazinan-2-one (PubChem CID 104601169) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-amino-3-[(4-methylphenyl)methyl]-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-[(4-methylphenyl)methyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601169 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-amino-3-[(4-methylphenyl)methyl]-1,3-diazinan-2-one |
| SMILES | Cc1ccc(CN2CCCN(N)C2=O)cc1 |
| InChI | InChI=1S/C12H17N3O/c1-10-3-5-11(6-4-10)9-14-7-2-8-15(13)12(14)16/h3-6H,2,7-9,13H2,1H3 |
| InChIKey | UGVLCDVFERPPCL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|