C11H13ClFN3O — CID 113431480
1-amino-3-[(2-chloro-3-fluorophenyl)methyl]-1,3-diazinan-2-one (PubChem CID 113431480) has the molecular formula C11H13ClFN3O and a molecular weight of 257.70 g/mol. Its IUPAC name is 1-amino-3-[(2-chloro-3-fluorophenyl)methyl]-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-[(2-chloro-3-fluorophenyl)methyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 113431480 |
| Molecular Formula | C11H13ClFN3O |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-amino-3-[(2-chloro-3-fluorophenyl)methyl]-1,3-diazinan-2-one |
| SMILES | NN1CCCN(Cc2cccc(F)c2Cl)C1=O |
| InChI | InChI=1S/C11H13ClFN3O/c12-10-8(3-1-4-9(10)13)7-15-5-2-6-16(14)11(15)17/h1,3-4H,2,5-7,14H2 |
| InChIKey | VKDCMODKMBWWHW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|