C10H16BrN5O — CID 104601268
1-amino-3-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1,3-diazinan-2-one (PubChem CID 104601268) has the molecular formula C10H16BrN5O and a molecular weight of 302.18 g/mol. Its IUPAC name is 1-amino-3-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1,3-diazinan-2-one.
| Compound Name | 1-amino-3-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104601268 |
| Molecular Formula | C10H16BrN5O |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-amino-3-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1,3-diazinan-2-one |
| SMILES | Cc1nn(C)c(CN2CCCN(N)C2=O)c1Br |
| InChI | InChI=1S/C10H16BrN5O/c1-7-9(11)8(14(2)13-7)6-15-4-3-5-16(12)10(15)17/h3-6,12H2,1-2H3 |
| InChIKey | JKTJLCXZVSIITG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|