About 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one
4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one (PubChem CID 104603543) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one.
Analyze 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one?
The IUPAC name of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one (CID 104603543) is 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one.
What is the SMILES notation for 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one?
The canonical SMILES for 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one is CC(=O)CC(C)Sc1ncnn1C.
What is the InChIKey of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one?
The InChIKey is UVWNPQLCEYTIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-6(12)4-7(2)13-8-9-5-10-11(8)3/h5,7H,4H2,1-3H3.
What are the key properties of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one?
4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one has a molecular weight of 199.28 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pentan-2-one is sourced from PubChem (CID 104603543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).