C5H9N5OS — CID 104604202
2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide (PubChem CID 104604202) has the molecular formula C5H9N5OS and a molecular weight of 187.23 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide.
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 104604202 |
| Molecular Formula | C5H9N5OS |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
| SMILES | Cn1ncnc1SCC(=O)NN |
| InChI | InChI=1S/C5H9N5OS/c1-10-5(7-3-8-10)12-2-4(11)9-6/h3H,2,6H2,1H3,(H,9,11) |
| InChIKey | LOYZDJZTAFBUAQ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|