C8H12N4OS — CID 86790312
2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide (PubChem CID 86790312) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 86790312 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1ncnn1C |
| InChI | InChI=1S/C8H12N4OS/c1-3-4-9-7(13)5-14-8-10-6-11-12(8)2/h3,6H,1,4-5H2,2H3,(H,9,13) |
| InChIKey | CFZOXKDWEZASGX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|