C8H11N3OS3 — CID 51140519
2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-prop-2-enylacetamide (PubChem CID 51140519) has the molecular formula C8H11N3OS3 and a molecular weight of 261.40 g/mol. Its IUPAC name is 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 51140519 |
| Molecular Formula | C8H11N3OS3 |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(SC)s1 |
| InChI | InChI=1S/C8H11N3OS3/c1-3-4-9-6(12)5-14-8-11-10-7(13-2)15-8/h3H,1,4-5H2,2H3,(H,9,12) |
| InChIKey | RPDBHPFHBZBISV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|