C6H11N3OS — CID 104588098
3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol (PubChem CID 104588098) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol.
| Compound Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 104588098 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol |
| SMILES | Cn1ncnc1SCCCO |
| InChI | InChI=1S/C6H11N3OS/c1-9-6(7-5-8-9)11-4-2-3-10/h5,10H,2-4H2,1H3 |
| InChIKey | ZHSSNURPZWWDDM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|