C10H11BFN3O2S — CID 104603625
[3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid (PubChem CID 104603625) has the molecular formula C10H11BFN3O2S and a molecular weight of 267.09 g/mol. Its IUPAC name is [3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 104603625 |
| Molecular Formula | C10H11BFN3O2S |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | [3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid |
| SMILES | Cn1ncnc1SCc1cc(F)cc(B(O)O)c1 |
| InChI | InChI=1S/C10H11BFN3O2S/c1-15-10(13-6-14-15)18-5-7-2-8(11(16)17)4-9(12)3-7/h2-4,6,16-17H,5H2,1H3 |
| InChIKey | BWUQHMZXESRTIP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|