C13H12FN3OS — CID 104603665
3-[2-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol (PubChem CID 104603665) has the molecular formula C13H12FN3OS and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[2-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 104603665 |
| Molecular Formula | C13H12FN3OS |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[2-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
| SMILES | Cn1ncnc1SCc1ccc(F)c(C#CCO)c1 |
| InChI | InChI=1S/C13H12FN3OS/c1-17-13(15-9-16-17)19-8-10-4-5-12(14)11(7-10)3-2-6-18/h4-5,7,9,18H,6,8H2,1H3 |
| InChIKey | HIGGBHSRTFKWRO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|